C25H22F3N3O — CID 42749040
2-(4-benzylpiperidine-1-carbonyl)-1-[3-(trifluoromethyl)phenyl]pyrrole-3-carbonitrile (PubChem CID 42749040) has the molecular formula C25H22F3N3O and a molecular weight of 437.47 g/mol. Its IUPAC name is 2-(4-benzylpiperidine-1-carbonyl)-1-[3-(trifluoromethyl)phenyl]pyrrole-3-carbonitrile.
| Compound Name | 2-(4-benzylpiperidine-1-carbonyl)-1-[3-(trifluoromethyl)phenyl]pyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 42749040 |
| Molecular Formula | C25H22F3N3O |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 2-(4-benzylpiperidine-1-carbonyl)-1-[3-(trifluoromethyl)phenyl]pyrrole-3-carbonitrile |
| SMILES | N#Cc1ccn(-c2cccc(C(F)(F)F)c2)c1C(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H22F3N3O/c26-25(27,28)21-7-4-8-22(16-21)31-14-11-20(17-29)23(31)24(32)30-12-9-19(10-13-30)15-18-5-2-1-3-6-18/h1-8,11,14,16,19H,9-10,12-13,15H2 |
| InChIKey | JAYDOJKNUANADS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |