C23H30N4O — CID 3886274
3-cyano-1-(3,4-dimethylphenyl)-N-[3-(2-methylpiperidin-1-yl)propyl]pyrrole-2-carboxamide (PubChem CID 3886274) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is 3-cyano-1-(3,4-dimethylphenyl)-N-[3-(2-methylpiperidin-1-yl)propyl]pyrrole-2-carboxamide.
| Compound Name | 3-cyano-1-(3,4-dimethylphenyl)-N-[3-(2-methylpiperidin-1-yl)propyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 3886274 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 3-cyano-1-(3,4-dimethylphenyl)-N-[3-(2-methylpiperidin-1-yl)propyl]pyrrole-2-carboxamide |
| SMILES | Cc1ccc(-n2ccc(C#N)c2C(=O)NCCCN2CCCCC2C)cc1C |
| InChI | InChI=1S/C23H30N4O/c1-17-8-9-21(15-18(17)2)27-14-10-20(16-24)22(27)23(28)25-11-6-13-26-12-5-4-7-19(26)3/h8-10,14-15,19H,4-7,11-13H2,1-3H3,(H,25,28) |
| InChIKey | BYURPAQEUSGFLD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|