C11H12F3N3OS — CID 78874535
1,1-bis(prop-2-enyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea (PubChem CID 78874535) has the molecular formula C11H12F3N3OS and a molecular weight of 291.30 g/mol. Its IUPAC name is 1,1-bis(prop-2-enyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1,1-bis(prop-2-enyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 78874535 |
| Molecular Formula | C11H12F3N3OS |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 1,1-bis(prop-2-enyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea |
| SMILES | C=CCN(CC=C)C(=O)Nc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C11H12F3N3OS/c1-3-5-17(6-4-2)10(18)16-9-15-8(7-19-9)11(12,13)14/h3-4,7H,1-2,5-6H2,(H,15,16,18) |
| InChIKey | ZFHJLUQYZZERKZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|