C10H15N3O3S2 — CID 91224760
tert-butyl N-[4-[1-(hydroxyamino)-2-sulfanylideneethyl]-1,3-thiazol-2-yl]carbamate (PubChem CID 91224760) has the molecular formula C10H15N3O3S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is tert-butyl N-[4-[1-(hydroxyamino)-2-sulfanylideneethyl]-1,3-thiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[1-(hydroxyamino)-2-sulfanylideneethyl]-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 91224760 |
| Molecular Formula | C10H15N3O3S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | tert-butyl N-[4-[1-(hydroxyamino)-2-sulfanylideneethyl]-1,3-thiazol-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc(C(C=S)NO)cs1 |
| InChI | InChI=1S/C10H15N3O3S2/c1-10(2,3)16-9(14)12-8-11-7(5-18-8)6(4-17)13-15/h4-6,13,15H,1-3H3,(H,11,12,14) |
| InChIKey | TWNJFCRALGIUPU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|