C16H20N4O3S — CID 53397291
tert-butyl N-[4-[(3-aminophenyl)methylcarbamoyl]-1,3-thiazol-2-yl]carbamate (PubChem CID 53397291) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is tert-butyl N-[4-[(3-aminophenyl)methylcarbamoyl]-1,3-thiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[(3-aminophenyl)methylcarbamoyl]-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 53397291 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | tert-butyl N-[4-[(3-aminophenyl)methylcarbamoyl]-1,3-thiazol-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc(C(=O)NCc2cccc(N)c2)cs1 |
| InChI | InChI=1S/C16H20N4O3S/c1-16(2,3)23-15(22)20-14-19-12(9-24-14)13(21)18-8-10-5-4-6-11(17)7-10/h4-7,9H,8,17H2,1-3H3,(H,18,21)(H,19,20,22) |
| InChIKey | OILRMRYWTRSKSQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|