C22H17N3O4S2 — CID 25405382
2-(benzenesulfonamido)-N-(4-phenoxyphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 25405382) has the molecular formula C22H17N3O4S2 and a molecular weight of 451.53 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-(4-phenoxyphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(benzenesulfonamido)-N-(4-phenoxyphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 25405382 |
| Molecular Formula | C22H17N3O4S2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | 2-(benzenesulfonamido)-N-(4-phenoxyphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)c1csc(NS(=O)(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C22H17N3O4S2/c26-21(23-16-11-13-18(14-12-16)29-17-7-3-1-4-8-17)20-15-30-22(24-20)25-31(27,28)19-9-5-2-6-10-19/h1-15H,(H,23,26)(H,24,25) |
| InChIKey | KHGUZQHTISOLQC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |