C22H17N5O5S2 — CID 16947933
2-[(4-methoxybenzoyl)amino]-N-(6-nitro-1,3-benzothiazol-2-yl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxamide (PubChem CID 16947933) has the molecular formula C22H17N5O5S2 and a molecular weight of 495.54 g/mol. Its IUPAC name is 2-[(4-methoxybenzoyl)amino]-N-(6-nitro-1,3-benzothiazol-2-yl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxamide.
| Compound Name | 2-[(4-methoxybenzoyl)amino]-N-(6-nitro-1,3-benzothiazol-2-yl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16947933 |
| Molecular Formula | C22H17N5O5S2 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | 2-[(4-methoxybenzoyl)amino]-N-(6-nitro-1,3-benzothiazol-2-yl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2nc3c(s2)CCC3C(=O)Nc2nc3ccc([N+](=O)[O-])cc3s2)cc1 |
| InChI | InChI=1S/C22H17N5O5S2/c1-32-13-5-2-11(3-6-13)19(28)25-22-24-18-14(7-9-16(18)33-22)20(29)26-21-23-15-8-4-12(27(30)31)10-17(15)34-21/h2-6,8,10,14H,7,9H2,1H3,(H,23,26,29)(H,24,25,28) |
| InChIKey | SQJRQDHMVBKKFV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|