C15H13FN2O4S2 — CID 3764092
N-(6-fluoro-1,3-benzothiazol-2-yl)-2,5-dimethoxybenzenesulfonamide (PubChem CID 3764092) has the molecular formula C15H13FN2O4S2 and a molecular weight of 368.41 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 3764092 |
| Molecular Formula | C15H13FN2O4S2 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Nc2nc3ccc(F)cc3s2)c1 |
| InChI | InChI=1S/C15H13FN2O4S2/c1-21-10-4-6-12(22-2)14(8-10)24(19,20)18-15-17-11-5-3-9(16)7-13(11)23-15/h3-8H,1-2H3,(H,17,18) |
| InChIKey | SKFMCSCFFLCDHH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |