C15H22ClN3O4S — CID 125161769
3-(2-chloro-5-sulfamoylphenyl)-1-methyl-1-[3-[(2R)-oxolan-2-yl]propyl]urea (PubChem CID 125161769) has the molecular formula C15H22ClN3O4S and a molecular weight of 375.88 g/mol. Its IUPAC name is 3-(2-chloro-5-sulfamoylphenyl)-1-methyl-1-[3-[(2R)-oxolan-2-yl]propyl]urea.
| Compound Name | 3-(2-chloro-5-sulfamoylphenyl)-1-methyl-1-[3-[(2R)-oxolan-2-yl]propyl]urea |
|---|---|
| PubChem CID | 125161769 |
| Molecular Formula | C15H22ClN3O4S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 3-(2-chloro-5-sulfamoylphenyl)-1-methyl-1-[3-[(2R)-oxolan-2-yl]propyl]urea |
| SMILES | CN(CCC[C@@H]1CCCO1)C(=O)Nc1cc(S(N)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C15H22ClN3O4S/c1-19(8-2-4-11-5-3-9-23-11)15(20)18-14-10-12(24(17,21)22)6-7-13(14)16/h6-7,10-11H,2-5,8-9H2,1H3,(H,18,20)(H2,17,21,22)/t11-/m1/s1 |
| InChIKey | IJOMKNBQHOGIHN-LLVKDONJSA-N |
| XLogP | 2.41 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |