C16H23ClN2O2 — CID 97279208
3-(2-chloro-5-methylphenyl)-1-methyl-1-[2-[(2R)-oxan-2-yl]ethyl]urea (PubChem CID 97279208) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.82 g/mol. Its IUPAC name is 3-(2-chloro-5-methylphenyl)-1-methyl-1-[2-[(2R)-oxan-2-yl]ethyl]urea.
| Compound Name | 3-(2-chloro-5-methylphenyl)-1-methyl-1-[2-[(2R)-oxan-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 97279208 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 3-(2-chloro-5-methylphenyl)-1-methyl-1-[2-[(2R)-oxan-2-yl]ethyl]urea |
| SMILES | Cc1ccc(Cl)c(NC(=O)N(C)CC[C@H]2CCCCO2)c1 |
| InChI | InChI=1S/C16H23ClN2O2/c1-12-6-7-14(17)15(11-12)18-16(20)19(2)9-8-13-5-3-4-10-21-13/h6-7,11,13H,3-5,8-10H2,1-2H3,(H,18,20)/t13-/m1/s1 |
| InChIKey | XQMRGQDJFQMPEO-CYBMUJFWSA-N |
| XLogP | 4.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |