C16H22F2N2O3 — CID 125165120
3-[4-(difluoromethoxy)phenyl]-1-methyl-1-[2-[(2S)-oxan-2-yl]ethyl]urea (PubChem CID 125165120) has the molecular formula C16H22F2N2O3 and a molecular weight of 328.36 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-1-methyl-1-[2-[(2S)-oxan-2-yl]ethyl]urea.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-1-methyl-1-[2-[(2S)-oxan-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 125165120 |
| Molecular Formula | C16H22F2N2O3 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-1-methyl-1-[2-[(2S)-oxan-2-yl]ethyl]urea |
| SMILES | CN(CC[C@@H]1CCCCO1)C(=O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H22F2N2O3/c1-20(10-9-13-4-2-3-11-22-13)16(21)19-12-5-7-14(8-6-12)23-15(17)18/h5-8,13,15H,2-4,9-11H2,1H3,(H,19,21)/t13-/m0/s1 |
| InChIKey | AYEJFIPCLOMWLR-ZDUSSCGKSA-N |
| XLogP | 3.71 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |