C16H22N2O4 — CID 125167071
3-(1,3-benzodioxol-5-yl)-1-methyl-1-[3-[(2R)-oxolan-2-yl]propyl]urea (PubChem CID 125167071) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-methyl-1-[3-[(2R)-oxolan-2-yl]propyl]urea.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-methyl-1-[3-[(2R)-oxolan-2-yl]propyl]urea |
|---|---|
| PubChem CID | 125167071 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-methyl-1-[3-[(2R)-oxolan-2-yl]propyl]urea |
| SMILES | CN(CCC[C@@H]1CCCO1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H22N2O4/c1-18(8-2-4-13-5-3-9-20-13)16(19)17-12-6-7-14-15(10-12)22-11-21-14/h6-7,10,13H,2-5,8-9,11H2,1H3,(H,17,19)/t13-/m1/s1 |
| InChIKey | LOSAYKLDYMITEA-CYBMUJFWSA-N |
| XLogP | 2.84 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |