C22H25N3O3 — CID 97436331
1-methyl-1-[3-[(2S)-oxolan-2-yl]propyl]-3-(2-phenyl-1,3-benzoxazol-5-yl)urea (PubChem CID 97436331) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-methyl-1-[3-[(2S)-oxolan-2-yl]propyl]-3-(2-phenyl-1,3-benzoxazol-5-yl)urea.
| Compound Name | 1-methyl-1-[3-[(2S)-oxolan-2-yl]propyl]-3-(2-phenyl-1,3-benzoxazol-5-yl)urea |
|---|---|
| PubChem CID | 97436331 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 1-methyl-1-[3-[(2S)-oxolan-2-yl]propyl]-3-(2-phenyl-1,3-benzoxazol-5-yl)urea |
| SMILES | CN(CCC[C@H]1CCCO1)C(=O)Nc1ccc2oc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C22H25N3O3/c1-25(13-5-9-18-10-6-14-27-18)22(26)23-17-11-12-20-19(15-17)24-21(28-20)16-7-3-2-4-8-16/h2-4,7-8,11-12,15,18H,5-6,9-10,13-14H2,1H3,(H,23,26)/t18-/m0/s1 |
| InChIKey | UZVQGIXEGXFOET-SFHVURJKSA-N |
| XLogP | 4.92 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |