C15H20Cl2N2O2 — CID 125165219
3-(2,4-dichloro-3-methylphenyl)-1-methyl-1-[[(2S)-oxan-2-yl]methyl]urea (PubChem CID 125165219) has the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is 3-(2,4-dichloro-3-methylphenyl)-1-methyl-1-[[(2S)-oxan-2-yl]methyl]urea.
| Compound Name | 3-(2,4-dichloro-3-methylphenyl)-1-methyl-1-[[(2S)-oxan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 125165219 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 3-(2,4-dichloro-3-methylphenyl)-1-methyl-1-[[(2S)-oxan-2-yl]methyl]urea |
| SMILES | Cc1c(Cl)ccc(NC(=O)N(C)C[C@@H]2CCCCO2)c1Cl |
| InChI | InChI=1S/C15H20Cl2N2O2/c1-10-12(16)6-7-13(14(10)17)18-15(20)19(2)9-11-5-3-4-8-21-11/h6-7,11H,3-5,8-9H2,1-2H3,(H,18,20)/t11-/m0/s1 |
| InChIKey | CXURITGDEZDWFZ-NSHDSACASA-N |
| XLogP | 4.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |