C8H12N2O5S2 — CID 79026491
4-(2-hydroxyethylsulfonylamino)benzenesulfonamide (PubChem CID 79026491) has the molecular formula C8H12N2O5S2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 4-(2-hydroxyethylsulfonylamino)benzenesulfonamide.
| Compound Name | 4-(2-hydroxyethylsulfonylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 79026491 |
| Molecular Formula | C8H12N2O5S2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 4-(2-hydroxyethylsulfonylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NS(=O)(=O)CCO)cc1 |
| InChI | InChI=1S/C8H12N2O5S2/c9-17(14,15)8-3-1-7(2-4-8)10-16(12,13)6-5-11/h1-4,10-11H,5-6H2,(H2,9,14,15) |
| InChIKey | JOLWCRAMVWSFPE-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |