C9H15N3O4S2 — CID 114812408
4-(propylsulfamoylamino)benzenesulfonamide (PubChem CID 114812408) has the molecular formula C9H15N3O4S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-(propylsulfamoylamino)benzenesulfonamide.
| Compound Name | 4-(propylsulfamoylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 114812408 |
| Molecular Formula | C9H15N3O4S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 4-(propylsulfamoylamino)benzenesulfonamide |
| SMILES | CCCNS(=O)(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C9H15N3O4S2/c1-2-7-11-18(15,16)12-8-3-5-9(6-4-8)17(10,13)14/h3-6,11-12H,2,7H2,1H3,(H2,10,13,14) |
| InChIKey | LEJSTAQDCIYMAX-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |