C14H21NO3S — CID 81192653
3-methyl-4-[3-(oxolan-2-yl)propylsulfonyl]aniline (PubChem CID 81192653) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 3-methyl-4-[3-(oxolan-2-yl)propylsulfonyl]aniline.
| Compound Name | 3-methyl-4-[3-(oxolan-2-yl)propylsulfonyl]aniline |
|---|---|
| PubChem CID | 81192653 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3-methyl-4-[3-(oxolan-2-yl)propylsulfonyl]aniline |
| SMILES | Cc1cc(N)ccc1S(=O)(=O)CCCC1CCCO1 |
| InChI | InChI=1S/C14H21NO3S/c1-11-10-12(15)6-7-14(11)19(16,17)9-3-5-13-4-2-8-18-13/h6-7,10,13H,2-5,8-9,15H2,1H3 |
| InChIKey | USUXCNTVNCWYCP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|