About 2-(oxolan-2-yl)ethyl 4-amino-2-methylbenzoate
2-(oxolan-2-yl)ethyl 4-amino-2-methylbenzoate (PubChem CID 65166044) has the molecular formula C14H19NO3
and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-(oxolan-2-yl)ethyl 4-amino-2-methylbenzoate.
Molecular Properties
| Compound Name | 2-(oxolan-2-yl)ethyl 4-amino-2-methylbenzoate |
| PubChem CID | 65166044 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 2-(oxolan-2-yl)ethyl 4-amino-2-methylbenzoate |
| SMILES | Cc1cc(N)ccc1C(=O)OCCC1CCCO1 |
| InChI | InChI=1S/C14H19NO3/c1-10-9-11(15)4-5-13(10)14(16)18-8-6-12-3-2-7-17-12/h4-5,9,12H,2-3,6-8,15H2,1H3 |
| InChIKey | QFEMNMRRADFMRP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxolan-2-yl)ethyl 4-amino-2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxolan-2-yl)ethyl 4-amino-2-methylbenzoate?
The IUPAC name of 2-(oxolan-2-yl)ethyl 4-amino-2-methylbenzoate (CID 65166044) is 2-(oxolan-2-yl)ethyl 4-amino-2-methylbenzoate.
What is the SMILES notation for 2-(oxolan-2-yl)ethyl 4-amino-2-methylbenzoate?
The canonical SMILES for 2-(oxolan-2-yl)ethyl 4-amino-2-methylbenzoate is Cc1cc(N)ccc1C(=O)OCCC1CCCO1.
What is the InChIKey of 2-(oxolan-2-yl)ethyl 4-amino-2-methylbenzoate?
The InChIKey is QFEMNMRRADFMRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3/c1-10-9-11(15)4-5-13(10)14(16)18-8-6-12-3-2-7-17-12/h4-5,9,12H,2-3,6-8,15H2,1H3.
What are the key properties of 2-(oxolan-2-yl)ethyl 4-amino-2-methylbenzoate?
2-(oxolan-2-yl)ethyl 4-amino-2-methylbenzoate has a molecular weight of 249.31 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxolan-2-yl)ethyl 4-amino-2-methylbenzoate is sourced from PubChem (CID 65166044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).