About 2-(oxolan-2-yl)ethyl 3-amino-4-ethoxybenzoate
2-(oxolan-2-yl)ethyl 3-amino-4-ethoxybenzoate (PubChem CID 65166568) has the molecular formula C15H21NO4
and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-(oxolan-2-yl)ethyl 3-amino-4-ethoxybenzoate.
Molecular Properties
| Compound Name | 2-(oxolan-2-yl)ethyl 3-amino-4-ethoxybenzoate |
| PubChem CID | 65166568 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-(oxolan-2-yl)ethyl 3-amino-4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCCC2CCCO2)cc1N |
| InChI | InChI=1S/C15H21NO4/c1-2-18-14-6-5-11(10-13(14)16)15(17)20-9-7-12-4-3-8-19-12/h5-6,10,12H,2-4,7-9,16H2,1H3 |
| InChIKey | PKGBSMZWFRGUFZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxolan-2-yl)ethyl 3-amino-4-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxolan-2-yl)ethyl 3-amino-4-ethoxybenzoate?
The IUPAC name of 2-(oxolan-2-yl)ethyl 3-amino-4-ethoxybenzoate (CID 65166568) is 2-(oxolan-2-yl)ethyl 3-amino-4-ethoxybenzoate.
What is the SMILES notation for 2-(oxolan-2-yl)ethyl 3-amino-4-ethoxybenzoate?
The canonical SMILES for 2-(oxolan-2-yl)ethyl 3-amino-4-ethoxybenzoate is CCOc1ccc(C(=O)OCCC2CCCO2)cc1N.
What is the InChIKey of 2-(oxolan-2-yl)ethyl 3-amino-4-ethoxybenzoate?
The InChIKey is PKGBSMZWFRGUFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO4/c1-2-18-14-6-5-11(10-13(14)16)15(17)20-9-7-12-4-3-8-19-12/h5-6,10,12H,2-4,7-9,16H2,1H3.
What are the key properties of 2-(oxolan-2-yl)ethyl 3-amino-4-ethoxybenzoate?
2-(oxolan-2-yl)ethyl 3-amino-4-ethoxybenzoate has a molecular weight of 279.34 g/mol, XLogP of 2.39, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxolan-2-yl)ethyl 3-amino-4-ethoxybenzoate is sourced from PubChem (CID 65166568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).