C12H8ClFO4S2 — CID 81461883
2-chloro-3-fluoro-5-(thiophen-2-ylmethylsulfonyl)benzoic acid (PubChem CID 81461883) has the molecular formula C12H8ClFO4S2 and a molecular weight of 334.78 g/mol. Its IUPAC name is 2-chloro-3-fluoro-5-(thiophen-2-ylmethylsulfonyl)benzoic acid.
| Compound Name | 2-chloro-3-fluoro-5-(thiophen-2-ylmethylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 81461883 |
| Molecular Formula | C12H8ClFO4S2 |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 333.95 |
| IUPAC Name | 2-chloro-3-fluoro-5-(thiophen-2-ylmethylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)Cc2cccs2)cc(F)c1Cl |
| InChI | InChI=1S/C12H8ClFO4S2/c13-11-9(12(15)16)4-8(5-10(11)14)20(17,18)6-7-2-1-3-19-7/h1-5H,6H2,(H,15,16) |
| InChIKey | YEXOBOLECRHNAB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |