C11H10F4O4S2 — CID 116616539
2-fluoro-3-methyl-5-[2-(trifluoromethylsulfanyl)ethylsulfonyl]benzoic acid (PubChem CID 116616539) has the molecular formula C11H10F4O4S2 and a molecular weight of 346.32 g/mol. Its IUPAC name is 2-fluoro-3-methyl-5-[2-(trifluoromethylsulfanyl)ethylsulfonyl]benzoic acid.
| Compound Name | 2-fluoro-3-methyl-5-[2-(trifluoromethylsulfanyl)ethylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 116616539 |
| Molecular Formula | C11H10F4O4S2 |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 2-fluoro-3-methyl-5-[2-(trifluoromethylsulfanyl)ethylsulfonyl]benzoic acid |
| SMILES | Cc1cc(S(=O)(=O)CCSC(F)(F)F)cc(C(=O)O)c1F |
| InChI | InChI=1S/C11H10F4O4S2/c1-6-4-7(5-8(9(6)12)10(16)17)21(18,19)3-2-20-11(13,14)15/h4-5H,2-3H2,1H3,(H,16,17) |
| InChIKey | IXCKSYKOUGTWQO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |