C16H24FN3O4S — CID 133239624
1-(dimethylsulfamoyl)-N-[2-(4-fluorophenoxy)ethyl]piperidine-3-carboxamide (PubChem CID 133239624) has the molecular formula C16H24FN3O4S and a molecular weight of 373.45 g/mol. Its IUPAC name is 1-(dimethylsulfamoyl)-N-[2-(4-fluorophenoxy)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-(dimethylsulfamoyl)-N-[2-(4-fluorophenoxy)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133239624 |
| Molecular Formula | C16H24FN3O4S |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1-(dimethylsulfamoyl)-N-[2-(4-fluorophenoxy)ethyl]piperidine-3-carboxamide |
| SMILES | CN(C)S(=O)(=O)N1CCCC(C(=O)NCCOc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C16H24FN3O4S/c1-19(2)25(22,23)20-10-3-4-13(12-20)16(21)18-9-11-24-15-7-5-14(17)6-8-15/h5-8,13H,3-4,9-12H2,1-2H3,(H,18,21) |
| InChIKey | OMXHBXQRVZDSDX-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|