C15H22FN3O3S — CID 22552921
N-ethyl-1-[(4-fluorophenyl)-methylsulfamoyl]piperidine-3-carboxamide (PubChem CID 22552921) has the molecular formula C15H22FN3O3S and a molecular weight of 343.42 g/mol. Its IUPAC name is N-ethyl-1-[(4-fluorophenyl)-methylsulfamoyl]piperidine-3-carboxamide.
| Compound Name | N-ethyl-1-[(4-fluorophenyl)-methylsulfamoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 22552921 |
| Molecular Formula | C15H22FN3O3S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-ethyl-1-[(4-fluorophenyl)-methylsulfamoyl]piperidine-3-carboxamide |
| SMILES | CCNC(=O)C1CCCN(S(=O)(=O)N(C)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C15H22FN3O3S/c1-3-17-15(20)12-5-4-10-19(11-12)23(21,22)18(2)14-8-6-13(16)7-9-14/h6-9,12H,3-5,10-11H2,1-2H3,(H,17,20) |
| InChIKey | GCYVFIKALHWVDI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |