C18H26FN3O3S — CID 92687132
(3R)-N-cyclopentyl-1-[(4-fluorophenyl)-methylsulfamoyl]piperidine-3-carboxamide (PubChem CID 92687132) has the molecular formula C18H26FN3O3S and a molecular weight of 383.49 g/mol. Its IUPAC name is (3R)-N-cyclopentyl-1-[(4-fluorophenyl)-methylsulfamoyl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-cyclopentyl-1-[(4-fluorophenyl)-methylsulfamoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92687132 |
| Molecular Formula | C18H26FN3O3S |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (3R)-N-cyclopentyl-1-[(4-fluorophenyl)-methylsulfamoyl]piperidine-3-carboxamide |
| SMILES | CN(c1ccc(F)cc1)S(=O)(=O)N1CCC[C@@H](C(=O)NC2CCCC2)C1 |
| InChI | InChI=1S/C18H26FN3O3S/c1-21(17-10-8-15(19)9-11-17)26(24,25)22-12-4-5-14(13-22)18(23)20-16-6-2-3-7-16/h8-11,14,16H,2-7,12-13H2,1H3,(H,20,23)/t14-/m1/s1 |
| InChIKey | DJIWHOJTFVDBIF-CQSZACIVSA-N |
| XLogP | 2.28 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |