C22H29N3O6S2 — CID 126325887
(2S)-2-(4-ethoxy-N-methylsulfonylanilino)-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide (PubChem CID 126325887) has the molecular formula C22H29N3O6S2 and a molecular weight of 495.62 g/mol. Its IUPAC name is (2S)-2-(4-ethoxy-N-methylsulfonylanilino)-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | (2S)-2-(4-ethoxy-N-methylsulfonylanilino)-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 126325887 |
| Molecular Formula | C22H29N3O6S2 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | (2S)-2-(4-ethoxy-N-methylsulfonylanilino)-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
| SMILES | CCOc1ccc(N([C@@H](C)C(=O)Nc2ccc(S(=O)(=O)N3CCCC3)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H29N3O6S2/c1-4-31-20-11-9-19(10-12-20)25(32(3,27)28)17(2)22(26)23-18-7-13-21(14-8-18)33(29,30)24-15-5-6-16-24/h7-14,17H,4-6,15-16H2,1-3H3,(H,23,26)/t17-/m0/s1 |
| InChIKey | LFAFFWBZVQGROA-KRWDZBQOSA-N |
| XLogP | 2.66 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |