C23H31N3O6S — CID 133252099
N-[2-(4-tert-butylphenoxy)ethyl]-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)propanamide (PubChem CID 133252099) has the molecular formula C23H31N3O6S and a molecular weight of 477.58 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenoxy)ethyl]-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)propanamide.
| Compound Name | N-[2-(4-tert-butylphenoxy)ethyl]-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)propanamide |
|---|---|
| PubChem CID | 133252099 |
| Molecular Formula | C23H31N3O6S |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | N-[2-(4-tert-butylphenoxy)ethyl]-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)propanamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N(C(C)C(=O)NCCOc1ccc(C(C)(C)C)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C23H31N3O6S/c1-16-7-10-19(26(28)29)15-21(16)25(33(6,30)31)17(2)22(27)24-13-14-32-20-11-8-18(9-12-20)23(3,4)5/h7-12,15,17H,13-14H2,1-6H3,(H,24,27) |
| InChIKey | WXXWBQPPBPBOPQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|