C19H20ClF3N2O3S — CID 132674576
2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-(2-phenylethyl)propanamide (PubChem CID 132674576) has the molecular formula C19H20ClF3N2O3S and a molecular weight of 448.89 g/mol. Its IUPAC name is 2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-(2-phenylethyl)propanamide.
| Compound Name | 2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 132674576 |
| Molecular Formula | C19H20ClF3N2O3S |
| Molecular Weight | 448.89 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-(2-phenylethyl)propanamide |
| SMILES | CC(C(=O)NCCc1ccccc1)N(c1ccc(Cl)c(C(F)(F)F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C19H20ClF3N2O3S/c1-13(18(26)24-11-10-14-6-4-3-5-7-14)25(29(2,27)28)15-8-9-17(20)16(12-15)19(21,22)23/h3-9,12-13H,10-11H2,1-2H3,(H,24,26) |
| InChIKey | FROYWZXEGKHUGA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.89 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |