C16H25FN2O3S2 — CID 53285821
N-(2-tert-butylsulfanylethyl)-2-(2-fluoro-N-methylsulfonylanilino)propanamide (PubChem CID 53285821) has the molecular formula C16H25FN2O3S2 and a molecular weight of 376.52 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-2-(2-fluoro-N-methylsulfonylanilino)propanamide.
| Compound Name | N-(2-tert-butylsulfanylethyl)-2-(2-fluoro-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 53285821 |
| Molecular Formula | C16H25FN2O3S2 |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-2-(2-fluoro-N-methylsulfonylanilino)propanamide |
| SMILES | CC(C(=O)NCCSC(C)(C)C)N(c1ccccc1F)S(C)(=O)=O |
| InChI | InChI=1S/C16H25FN2O3S2/c1-12(15(20)18-10-11-23-16(2,3)4)19(24(5,21)22)14-9-7-6-8-13(14)17/h6-9,12H,10-11H2,1-5H3,(H,18,20) |
| InChIKey | UKROAISXRFWNME-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|