C17H21FN2O4S — CID 53285782
2-(2-fluoro-N-methylsulfonylanilino)-N-[3-(furan-2-yl)propyl]propanamide (PubChem CID 53285782) has the molecular formula C17H21FN2O4S and a molecular weight of 368.43 g/mol. Its IUPAC name is 2-(2-fluoro-N-methylsulfonylanilino)-N-[3-(furan-2-yl)propyl]propanamide.
| Compound Name | 2-(2-fluoro-N-methylsulfonylanilino)-N-[3-(furan-2-yl)propyl]propanamide |
|---|---|
| PubChem CID | 53285782 |
| Molecular Formula | C17H21FN2O4S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-(2-fluoro-N-methylsulfonylanilino)-N-[3-(furan-2-yl)propyl]propanamide |
| SMILES | CC(C(=O)NCCCc1ccco1)N(c1ccccc1F)S(C)(=O)=O |
| InChI | InChI=1S/C17H21FN2O4S/c1-13(17(21)19-11-5-7-14-8-6-12-24-14)20(25(2,22)23)16-10-4-3-9-15(16)18/h3-4,6,8-10,12-13H,5,7,11H2,1-2H3,(H,19,21) |
| InChIKey | OFCOYVQCNPMSKB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|