C24H32N4O5S — CID 133190354
2-(2-methyl-N-methylsulfonyl-5-nitroanilino)-N-[[3-(piperidin-1-ylmethyl)phenyl]methyl]propanamide (PubChem CID 133190354) has the molecular formula C24H32N4O5S and a molecular weight of 488.61 g/mol. Its IUPAC name is 2-(2-methyl-N-methylsulfonyl-5-nitroanilino)-N-[[3-(piperidin-1-ylmethyl)phenyl]methyl]propanamide.
| Compound Name | 2-(2-methyl-N-methylsulfonyl-5-nitroanilino)-N-[[3-(piperidin-1-ylmethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 133190354 |
| Molecular Formula | C24H32N4O5S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 2-(2-methyl-N-methylsulfonyl-5-nitroanilino)-N-[[3-(piperidin-1-ylmethyl)phenyl]methyl]propanamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N(C(C)C(=O)NCc1cccc(CN2CCCCC2)c1)S(C)(=O)=O |
| InChI | InChI=1S/C24H32N4O5S/c1-18-10-11-22(28(30)31)15-23(18)27(34(3,32)33)19(2)24(29)25-16-20-8-7-9-21(14-20)17-26-12-5-4-6-13-26/h7-11,14-15,19H,4-6,12-13,16-17H2,1-3H3,(H,25,29) |
| InChIKey | FXYHPCWBSCBEHC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|