C25H34N4O5S — CID 133190375
2-(2-methyl-N-methylsulfonyl-5-nitroanilino)-N-[[3-(piperidin-1-ylmethyl)phenyl]methyl]butanamide (PubChem CID 133190375) has the molecular formula C25H34N4O5S and a molecular weight of 502.64 g/mol. Its IUPAC name is 2-(2-methyl-N-methylsulfonyl-5-nitroanilino)-N-[[3-(piperidin-1-ylmethyl)phenyl]methyl]butanamide.
| Compound Name | 2-(2-methyl-N-methylsulfonyl-5-nitroanilino)-N-[[3-(piperidin-1-ylmethyl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 133190375 |
| Molecular Formula | C25H34N4O5S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 2-(2-methyl-N-methylsulfonyl-5-nitroanilino)-N-[[3-(piperidin-1-ylmethyl)phenyl]methyl]butanamide |
| SMILES | CCC(C(=O)NCc1cccc(CN2CCCCC2)c1)N(c1cc([N+](=O)[O-])ccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C25H34N4O5S/c1-4-23(28(35(3,33)34)24-16-22(29(31)32)12-11-19(24)2)25(30)26-17-20-9-8-10-21(15-20)18-27-13-6-5-7-14-27/h8-12,15-16,23H,4-7,13-14,17-18H2,1-3H3,(H,26,30) |
| InChIKey | QPVIAQNHDAANSU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|