C16H21N5O5S3 — CID 100611309
(2S)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 100611309) has the molecular formula C16H21N5O5S3 and a molecular weight of 459.58 g/mol. Its IUPAC name is (2S)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | (2S)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 100611309 |
| Molecular Formula | C16H21N5O5S3 |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | (2S)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N([C@@H](C)C(=O)Nc1nnc(SC(C)C)s1)S(C)(=O)=O |
| InChI | InChI=1S/C16H21N5O5S3/c1-9(2)27-16-19-18-15(28-16)17-14(22)11(4)20(29(5,25)26)13-8-12(21(23)24)7-6-10(13)3/h6-9,11H,1-5H3,(H,17,18,22)/t11-/m0/s1 |
| InChIKey | URHZDPCKGAMIGJ-NSHDSACASA-N |
| XLogP | 3.05 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|