C20H21N5O5S2 — CID 133202466
2-(2-methyl-N-methylsulfonyl-5-nitroanilino)-N-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 133202466) has the molecular formula C20H21N5O5S2 and a molecular weight of 475.55 g/mol. Its IUPAC name is 2-(2-methyl-N-methylsulfonyl-5-nitroanilino)-N-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 2-(2-methyl-N-methylsulfonyl-5-nitroanilino)-N-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 133202466 |
| Molecular Formula | C20H21N5O5S2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 2-(2-methyl-N-methylsulfonyl-5-nitroanilino)-N-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | Cc1ccc(-c2nnc(NC(=O)C(C)N(c3cc([N+](=O)[O-])ccc3C)S(C)(=O)=O)s2)cc1 |
| InChI | InChI=1S/C20H21N5O5S2/c1-12-5-8-15(9-6-12)19-22-23-20(31-19)21-18(26)14(3)24(32(4,29)30)17-11-16(25(27)28)10-7-13(17)2/h5-11,14H,1-4H3,(H,21,23,26) |
| InChIKey | ASRKFMYKWMXPNV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|