C15H19FN4O3S3 — CID 100763363
(2S)-2-(4-fluoro-N-methylsulfonylanilino)-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 100763363) has the molecular formula C15H19FN4O3S3 and a molecular weight of 418.54 g/mol. Its IUPAC name is (2S)-2-(4-fluoro-N-methylsulfonylanilino)-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | (2S)-2-(4-fluoro-N-methylsulfonylanilino)-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 100763363 |
| Molecular Formula | C15H19FN4O3S3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | (2S)-2-(4-fluoro-N-methylsulfonylanilino)-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CC(C)Sc1nnc(NC(=O)[C@H](C)N(c2ccc(F)cc2)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C15H19FN4O3S3/c1-9(2)24-15-19-18-14(25-15)17-13(21)10(3)20(26(4,22)23)12-7-5-11(16)6-8-12/h5-10H,1-4H3,(H,17,18,21)/t10-/m0/s1 |
| InChIKey | YRLCJHVMICVPIZ-JTQLQIEISA-N |
| XLogP | 2.97 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|