C17H24N4O5S3 — CID 133201517
2-(3,4-dimethoxy-N-methylsulfonylanilino)-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 133201517) has the molecular formula C17H24N4O5S3 and a molecular weight of 460.60 g/mol. Its IUPAC name is 2-(3,4-dimethoxy-N-methylsulfonylanilino)-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 2-(3,4-dimethoxy-N-methylsulfonylanilino)-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 133201517 |
| Molecular Formula | C17H24N4O5S3 |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 2-(3,4-dimethoxy-N-methylsulfonylanilino)-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | COc1ccc(N(C(C)C(=O)Nc2nnc(SC(C)C)s2)S(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C17H24N4O5S3/c1-10(2)27-17-20-19-16(28-17)18-15(22)11(3)21(29(6,23)24)12-7-8-13(25-4)14(9-12)26-5/h7-11H,1-6H3,(H,18,19,22) |
| InChIKey | LYPJMDJTZFJQAN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|