C18H20Cl2N2O5S — CID 132674088
N-(3,4-dichlorophenyl)-2-(3,4-dimethoxy-N-methylsulfonylanilino)propanamide (PubChem CID 132674088) has the molecular formula C18H20Cl2N2O5S and a molecular weight of 447.34 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-(3,4-dimethoxy-N-methylsulfonylanilino)propanamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-(3,4-dimethoxy-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 132674088 |
| Molecular Formula | C18H20Cl2N2O5S |
| Molecular Weight | 447.34 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-(3,4-dimethoxy-N-methylsulfonylanilino)propanamide |
| SMILES | COc1ccc(N(C(C)C(=O)Nc2ccc(Cl)c(Cl)c2)S(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C18H20Cl2N2O5S/c1-11(18(23)21-12-5-7-14(19)15(20)9-12)22(28(4,24)25)13-6-8-16(26-2)17(10-13)27-3/h5-11H,1-4H3,(H,21,23) |
| InChIKey | XQCXYZCZGBDFOB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |