C20H24N2O7S — CID 132670718
methyl 4-[2-(3,4-dimethoxy-N-methylsulfonylanilino)propanoylamino]benzoate (PubChem CID 132670718) has the molecular formula C20H24N2O7S and a molecular weight of 436.49 g/mol. Its IUPAC name is methyl 4-[2-(3,4-dimethoxy-N-methylsulfonylanilino)propanoylamino]benzoate.
| Compound Name | methyl 4-[2-(3,4-dimethoxy-N-methylsulfonylanilino)propanoylamino]benzoate |
|---|---|
| PubChem CID | 132670718 |
| Molecular Formula | C20H24N2O7S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | methyl 4-[2-(3,4-dimethoxy-N-methylsulfonylanilino)propanoylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C(C)N(c2ccc(OC)c(OC)c2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H24N2O7S/c1-13(19(23)21-15-8-6-14(7-9-15)20(24)29-4)22(30(5,25)26)16-10-11-17(27-2)18(12-16)28-3/h6-13H,1-5H3,(H,21,23) |
| InChIKey | IKRCFQVOTNSROP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |