C17H24N4O4S3 — CID 125054220
(2R)-2-(4-methoxy-N-methylsulfonylanilino)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 125054220) has the molecular formula C17H24N4O4S3 and a molecular weight of 444.60 g/mol. Its IUPAC name is (2R)-2-(4-methoxy-N-methylsulfonylanilino)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | (2R)-2-(4-methoxy-N-methylsulfonylanilino)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 125054220 |
| Molecular Formula | C17H24N4O4S3 |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | (2R)-2-(4-methoxy-N-methylsulfonylanilino)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | COc1ccc(N([C@H](C)C(=O)Nc2nnc(SCC(C)C)s2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H24N4O4S3/c1-11(2)10-26-17-20-19-16(27-17)18-15(22)12(3)21(28(5,23)24)13-6-8-14(25-4)9-7-13/h6-9,11-12H,10H2,1-5H3,(H,18,19,22)/t12-/m1/s1 |
| InChIKey | QMPAPNJRSIIMJF-GFCCVEGCSA-N |
| XLogP | 3.09 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|