C16H20N4O6S3 — CID 100541037
methyl 2-[[5-[[(2R)-2-(4-methoxy-N-methylsulfonylanilino)propanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 100541037) has the molecular formula C16H20N4O6S3 and a molecular weight of 460.56 g/mol. Its IUPAC name is methyl 2-[[5-[[(2R)-2-(4-methoxy-N-methylsulfonylanilino)propanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[5-[[(2R)-2-(4-methoxy-N-methylsulfonylanilino)propanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 100541037 |
| Molecular Formula | C16H20N4O6S3 |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | methyl 2-[[5-[[(2R)-2-(4-methoxy-N-methylsulfonylanilino)propanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1nnc(NC(=O)[C@@H](C)N(c2ccc(OC)cc2)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C16H20N4O6S3/c1-10(20(29(4,23)24)11-5-7-12(25-2)8-6-11)14(22)17-15-18-19-16(28-15)27-9-13(21)26-3/h5-8,10H,9H2,1-4H3,(H,17,18,22)/t10-/m1/s1 |
| InChIKey | YJTKYMXFBKCIPS-SNVBAGLBSA-N |
| XLogP | 1.61 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|