C13H16N4O4S3 — CID 100641233
2-methyl-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-nitrobenzenesulfonamide (PubChem CID 100641233) has the molecular formula C13H16N4O4S3 and a molecular weight of 388.50 g/mol. Its IUPAC name is 2-methyl-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-nitrobenzenesulfonamide.
| Compound Name | 2-methyl-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 100641233 |
| Molecular Formula | C13H16N4O4S3 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 2-methyl-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-nitrobenzenesulfonamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)Nc1nnc(SCC(C)C)s1 |
| InChI | InChI=1S/C13H16N4O4S3/c1-8(2)7-22-13-15-14-12(23-13)16-24(20,21)11-6-10(17(18)19)5-4-9(11)3/h4-6,8H,7H2,1-3H3,(H,14,16) |
| InChIKey | OTFZEUXIHWGFLH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|