C19H15ClN4OS2 — CID 29456625
3-(2-chlorophenyl)-N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 29456625) has the molecular formula C19H15ClN4OS2 and a molecular weight of 414.94 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 3-(2-chlorophenyl)-N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 29456625 |
| Molecular Formula | C19H15ClN4OS2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | N#Cc1ccc(CSc2nnc(NC(=O)CCc3ccccc3Cl)s2)cc1 |
| InChI | InChI=1S/C19H15ClN4OS2/c20-16-4-2-1-3-15(16)9-10-17(25)22-18-23-24-19(27-18)26-12-14-7-5-13(11-21)6-8-14/h1-8H,9-10,12H2,(H,22,23,25) |
| InChIKey | VZNLBRGETYYWQN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|