C20H16N6OS2 — CID 78818426
3-(benzimidazol-1-yl)-N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 78818426) has the molecular formula C20H16N6OS2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 3-(benzimidazol-1-yl)-N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 3-(benzimidazol-1-yl)-N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 78818426 |
| Molecular Formula | C20H16N6OS2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 3-(benzimidazol-1-yl)-N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | N#Cc1ccc(CSc2nnc(NC(=O)CCn3cnc4ccccc43)s2)cc1 |
| InChI | InChI=1S/C20H16N6OS2/c21-11-14-5-7-15(8-6-14)12-28-20-25-24-19(29-20)23-18(27)9-10-26-13-22-16-3-1-2-4-17(16)26/h1-8,13H,9-10,12H2,(H,23,24,27) |
| InChIKey | VKAOXXVMYZAEQC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|