C18H12ClFN4OS2 — CID 2458256
2-(2-chloro-6-fluorophenyl)-N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 2458256) has the molecular formula C18H12ClFN4OS2 and a molecular weight of 418.91 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 2458256 |
| Molecular Formula | C18H12ClFN4OS2 |
| Molecular Weight | 418.91 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | N#Cc1ccc(CSc2nnc(NC(=O)Cc3c(F)cccc3Cl)s2)cc1 |
| InChI | InChI=1S/C18H12ClFN4OS2/c19-14-2-1-3-15(20)13(14)8-16(25)22-17-23-24-18(27-17)26-10-12-6-4-11(9-21)5-7-12/h1-7H,8,10H2,(H,22,23,25) |
| InChIKey | IZQAWZMQTGJSJG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.91 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|