C19H16N4OS3 — CID 29298321
N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(2-methylphenyl)sulfanylacetamide (PubChem CID 29298321) has the molecular formula C19H16N4OS3 and a molecular weight of 412.57 g/mol. Its IUPAC name is N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(2-methylphenyl)sulfanylacetamide.
| Compound Name | N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(2-methylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 29298321 |
| Molecular Formula | C19H16N4OS3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(2-methylphenyl)sulfanylacetamide |
| SMILES | Cc1ccccc1SCC(=O)Nc1nnc(SCc2ccc(C#N)cc2)s1 |
| InChI | InChI=1S/C19H16N4OS3/c1-13-4-2-3-5-16(13)25-12-17(24)21-18-22-23-19(27-18)26-11-15-8-6-14(10-20)7-9-15/h2-9H,11-12H2,1H3,(H,21,22,24) |
| InChIKey | CZDYTGPRAAHJTB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|