C20H18N4OS2 — CID 8912682
N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(3,4-dimethylphenyl)acetamide (PubChem CID 8912682) has the molecular formula C20H18N4OS2 and a molecular weight of 394.53 g/mol. Its IUPAC name is N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(3,4-dimethylphenyl)acetamide.
| Compound Name | N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 8912682 |
| Molecular Formula | C20H18N4OS2 |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(3,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)Nc2nnc(SCc3ccc(C#N)cc3)s2)cc1C |
| InChI | InChI=1S/C20H18N4OS2/c1-13-3-4-17(9-14(13)2)10-18(25)22-19-23-24-20(27-19)26-12-16-7-5-15(11-21)6-8-16/h3-9H,10,12H2,1-2H3,(H,22,23,25) |
| InChIKey | ZLYUFHQCHGHAMX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|