C15H15N5O3S2 — CID 122076870
4-[[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]carbamoylamino]butanoic acid (PubChem CID 122076870) has the molecular formula C15H15N5O3S2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 4-[[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122076870 |
| Molecular Formula | C15H15N5O3S2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 4-[[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]carbamoylamino]butanoic acid |
| SMILES | N#Cc1ccc(CSc2nnc(NC(=O)NCCCC(=O)O)s2)cc1 |
| InChI | InChI=1S/C15H15N5O3S2/c16-8-10-3-5-11(6-4-10)9-24-15-20-19-14(25-15)18-13(23)17-7-1-2-12(21)22/h3-6H,1-2,7,9H2,(H,21,22)(H2,17,18,19,23) |
| InChIKey | LDHVVQJVPBTBNC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|