C16H13N5OS3 — CID 29456628
N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide (PubChem CID 29456628) has the molecular formula C16H13N5OS3 and a molecular weight of 387.52 g/mol. Its IUPAC name is N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 29456628 |
| Molecular Formula | C16H13N5OS3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
| SMILES | Cc1nc(CC(=O)Nc2nnc(SCc3ccc(C#N)cc3)s2)cs1 |
| InChI | InChI=1S/C16H13N5OS3/c1-10-18-13(9-23-10)6-14(22)19-15-20-21-16(25-15)24-8-12-4-2-11(7-17)3-5-12/h2-5,9H,6,8H2,1H3,(H,19,20,22) |
| InChIKey | NKDKIHIUQDYJDN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|