C21H14FN5OS3 — CID 16557152
N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 16557152) has the molecular formula C21H14FN5OS3 and a molecular weight of 467.58 g/mol. Its IUPAC name is N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 16557152 |
| Molecular Formula | C21H14FN5OS3 |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | N#Cc1ccc(CSc2nnc(NC(=O)Cc3csc(-c4ccc(F)cc4)n3)s2)cc1 |
| InChI | InChI=1S/C21H14FN5OS3/c22-16-7-5-15(6-8-16)19-24-17(12-29-19)9-18(28)25-20-26-27-21(31-20)30-11-14-3-1-13(10-23)2-4-14/h1-8,12H,9,11H2,(H,25,26,28) |
| InChIKey | LHCYKBLCEAQVRI-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|