C20H13N5OS3 — CID 60599667
N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 60599667) has the molecular formula C20H13N5OS3 and a molecular weight of 435.56 g/mol. Its IUPAC name is N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-phenyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-phenyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 60599667 |
| Molecular Formula | C20H13N5OS3 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | N#Cc1ccc(CSc2nnc(NC(=O)c3csc(-c4ccccc4)n3)s2)cc1 |
| InChI | InChI=1S/C20H13N5OS3/c21-10-13-6-8-14(9-7-13)11-28-20-25-24-19(29-20)23-17(26)16-12-27-18(22-16)15-4-2-1-3-5-15/h1-9,12H,11H2,(H,23,24,26) |
| InChIKey | DTNHHXGOZCIXNZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|