C19H13N5O2S3 — CID 43055803
N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(furan-2-yl)-5-methyl-1,3-thiazole-4-carboxamide (PubChem CID 43055803) has the molecular formula C19H13N5O2S3 and a molecular weight of 439.55 g/mol. Its IUPAC name is N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(furan-2-yl)-5-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(furan-2-yl)-5-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 43055803 |
| Molecular Formula | C19H13N5O2S3 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.02 |
| IUPAC Name | N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(furan-2-yl)-5-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1sc(-c2ccco2)nc1C(=O)Nc1nnc(SCc2ccc(C#N)cc2)s1 |
| InChI | InChI=1S/C19H13N5O2S3/c1-11-15(21-17(28-11)14-3-2-8-26-14)16(25)22-18-23-24-19(29-18)27-10-13-6-4-12(9-20)5-7-13/h2-8H,10H2,1H3,(H,22,23,25) |
| InChIKey | ZTDXPSVENSLTLC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|